C18H20F3N5O — CID 71786624
1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 71786624) has the molecular formula C18H20F3N5O and a molecular weight of 379.39 g/mol. Its IUPAC name is 1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 71786624 |
| Molecular Formula | C18H20F3N5O |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCC1CCN(c2cnccn2)CC1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3N5O/c19-18(20,21)14-2-1-3-15(10-14)25-17(27)24-11-13-4-8-26(9-5-13)16-12-22-6-7-23-16/h1-3,6-7,10,12-13H,4-5,8-9,11H2,(H2,24,25,27) |
| InChIKey | YKLFCZYVTIDIPK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |