C17H17F3N4O2 — CID 91843932
N-[(3R,4R)-3-hydroxy-1-pyrazin-2-ylpiperidin-4-yl]-3-(trifluoromethyl)benzamide (PubChem CID 91843932) has the molecular formula C17H17F3N4O2 and a molecular weight of 366.34 g/mol. Its IUPAC name is N-[(3R,4R)-3-hydroxy-1-pyrazin-2-ylpiperidin-4-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(3R,4R)-3-hydroxy-1-pyrazin-2-ylpiperidin-4-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91843932 |
| Molecular Formula | C17H17F3N4O2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-[(3R,4R)-3-hydroxy-1-pyrazin-2-ylpiperidin-4-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@@H]1CCN(c2cnccn2)C[C@H]1O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N4O2/c18-17(19,20)12-3-1-2-11(8-12)16(26)23-13-4-7-24(10-14(13)25)15-9-21-5-6-22-15/h1-3,5-6,8-9,13-14,25H,4,7,10H2,(H,23,26)/t13-,14-/m1/s1 |
| InChIKey | IODTXMNWYFCYRP-ZIAGYGMSSA-N |
| XLogP | 1.87 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |