C24H23F3N6O4S — CID 166376481
1-(1-pyridin-2-ylpyrrolidin-3-yl)-3-[[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoyl]amino]urea (PubChem CID 166376481) has the molecular formula C24H23F3N6O4S and a molecular weight of 548.55 g/mol. Its IUPAC name is 1-(1-pyridin-2-ylpyrrolidin-3-yl)-3-[[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoyl]amino]urea.
| Compound Name | 1-(1-pyridin-2-ylpyrrolidin-3-yl)-3-[[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoyl]amino]urea |
|---|---|
| PubChem CID | 166376481 |
| Molecular Formula | C24H23F3N6O4S |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 1-(1-pyridin-2-ylpyrrolidin-3-yl)-3-[[3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzoyl]amino]urea |
| SMILES | O=C(NNC(=O)c1cccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)c1)NC1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C24H23F3N6O4S/c25-24(26,27)17-6-4-7-18(14-17)32-38(36,37)20-8-3-5-16(13-20)22(34)30-31-23(35)29-19-10-12-33(15-19)21-9-1-2-11-28-21/h1-9,11,13-14,19,32H,10,12,15H2,(H,30,34)(H2,29,31,35) |
| InChIKey | WBJWOZIHJQOLQG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|