C17H12F3N3O3S2 — CID 2376546
N-(1,3-thiazol-2-yl)-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide (PubChem CID 2376546) has the molecular formula C17H12F3N3O3S2 and a molecular weight of 427.43 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide.
| Compound Name | N-(1,3-thiazol-2-yl)-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2376546 |
| Molecular Formula | C17H12F3N3O3S2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
| SMILES | O=C(Nc1nccs1)c1cccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H12F3N3O3S2/c18-17(19,20)12-4-2-5-13(10-12)23-28(25,26)14-6-1-3-11(9-14)15(24)22-16-21-7-8-27-16/h1-10,23H,(H,21,22,24) |
| InChIKey | OTTRBMZMOSLREL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |