C15H17N3O3S2 — CID 166188646
3-(cyclopentylsulfamoyl)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 166188646) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 166188646 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C15H17N3O3S2/c19-14(17-15-16-8-9-22-15)11-4-3-7-13(10-11)23(20,21)18-12-5-1-2-6-12/h3-4,7-10,12,18H,1-2,5-6H2,(H,16,17,19) |
| InChIKey | MZODOAIRJMDPQV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |