C14H12N4O4S2 — CID 27257413
3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 27257413) has the molecular formula C14H12N4O4S2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 27257413 |
| Molecular Formula | C14H12N4O4S2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cccc(C(=O)Nc3nccs3)c2)no1 |
| InChI | InChI=1S/C14H12N4O4S2/c1-9-7-12(17-22-9)18-24(20,21)11-4-2-3-10(8-11)13(19)16-14-15-5-6-23-14/h2-8H,1H3,(H,17,18)(H,15,16,19) |
| InChIKey | BJXHWSNIYIMJCC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |