C18H19N5O2 — CID 91841370
N-[(3R,4R)-3-hydroxy-1-pyrazin-2-ylpiperidin-4-yl]-1H-indole-6-carboxamide (PubChem CID 91841370) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[(3R,4R)-3-hydroxy-1-pyrazin-2-ylpiperidin-4-yl]-1H-indole-6-carboxamide.
| Compound Name | N-[(3R,4R)-3-hydroxy-1-pyrazin-2-ylpiperidin-4-yl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 91841370 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(3R,4R)-3-hydroxy-1-pyrazin-2-ylpiperidin-4-yl]-1H-indole-6-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(c2cnccn2)C[C@H]1O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C18H19N5O2/c24-16-11-23(17-10-19-6-7-21-17)8-4-14(16)22-18(25)13-2-1-12-3-5-20-15(12)9-13/h1-3,5-7,9-10,14,16,20,24H,4,8,11H2,(H,22,25)/t14-,16-/m1/s1 |
| InChIKey | YXDINRVFVBEMAY-GDBMZVCRSA-N |
| XLogP | 1.33 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |