C18H23N5O2 — CID 126433211
3-(2-aminoethoxy)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]benzamide (PubChem CID 126433211) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]benzamide.
| Compound Name | 3-(2-aminoethoxy)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126433211 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3-(2-aminoethoxy)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]benzamide |
| SMILES | NCCOc1cccc(C(=O)N[C@H]2CCCN(c3cnccn3)C2)c1 |
| InChI | InChI=1S/C18H23N5O2/c19-6-10-25-16-5-1-3-14(11-16)18(24)22-15-4-2-9-23(13-15)17-12-20-7-8-21-17/h1,3,5,7-8,11-12,15H,2,4,6,9-10,13,19H2,(H,22,24)/t15-/m0/s1 |
| InChIKey | CLYYCHRJKOEGRK-HNNXBMFYSA-N |
| XLogP | 1.21 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |