C23H27Cl3N4OS — CID 3006343
(2S)-2-[(4-chlorophenyl)carbamothioylamino]-N-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]methyl]propanamide (PubChem CID 3006343) has the molecular formula C23H27Cl3N4OS and a molecular weight of 513.92 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)carbamothioylamino]-N-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]methyl]propanamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)carbamothioylamino]-N-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 3006343 |
| Molecular Formula | C23H27Cl3N4OS |
| Molecular Weight | 513.92 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)carbamothioylamino]-N-[[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]methyl]propanamide |
| SMILES | C[C@H](NC(=S)Nc1ccc(Cl)cc1)C(=O)NCC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C23H27Cl3N4OS/c1-15(28-23(32)29-19-5-3-18(24)4-6-19)22(31)27-13-16-8-10-30(11-9-16)14-17-2-7-20(25)21(26)12-17/h2-7,12,15-16H,8-11,13-14H2,1H3,(H,27,31)(H2,28,29,32)/t15-/m0/s1 |
| InChIKey | DZYWEERGOWMWLG-HNNXBMFYSA-N |
| XLogP | 5.35 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.92 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|