C29H34F6N4O3 — CID 154331587
1-(cyclopropylmethyl)-3-[4-[4-[1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]butyl]piperazine-1-carbonyl]phenyl]urea (PubChem CID 154331587) has the molecular formula C29H34F6N4O3 and a molecular weight of 600.60 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[4-[4-[1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]butyl]piperazine-1-carbonyl]phenyl]urea.
| Compound Name | 1-(cyclopropylmethyl)-3-[4-[4-[1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]butyl]piperazine-1-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 154331587 |
| Molecular Formula | C29H34F6N4O3 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[4-[4-[1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]butyl]piperazine-1-carbonyl]phenyl]urea |
| SMILES | CCCC(c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)N1CCN(C(=O)c2ccc(NC(=O)NCC3CC3)cc2)CC1 |
| InChI | InChI=1S/C29H34F6N4O3/c1-2-3-24(20-6-10-22(11-7-20)27(42,28(30,31)32)29(33,34)35)38-14-16-39(17-15-38)25(40)21-8-12-23(13-9-21)37-26(41)36-18-19-4-5-19/h6-13,19,24,42H,2-5,14-18H2,1H3,(H2,36,37,41) |
| InChIKey | PHHNIZWOUBADTF-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |