C26H31F6N3O4 — CID 88898164
1-(2,3-dihydroxypropyl)-3-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]urea (PubChem CID 88898164) has the molecular formula C26H31F6N3O4 and a molecular weight of 563.54 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]urea.
| Compound Name | 1-(2,3-dihydroxypropyl)-3-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 88898164 |
| Molecular Formula | C26H31F6N3O4 |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3-[4-[[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]piperidin-4-yl]methyl]phenyl]urea |
| SMILES | O=C(NCC(O)CO)Nc1ccc(CC2CCN(Cc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H31F6N3O4/c27-25(28,29)24(39,26(30,31)32)20-5-1-19(2-6-20)15-35-11-9-18(10-12-35)13-17-3-7-21(8-4-17)34-23(38)33-14-22(37)16-36/h1-8,18,22,36-37,39H,9-16H2,(H2,33,34,38) |
| InChIKey | CXSCFJVCYFLQNI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |