C31H28F9NO5 — CID 46943289
2-[4-[4-[[4-(1,3-benzodioxol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,2,2-trifluoroacetic acid (PubChem CID 46943289) has the molecular formula C31H28F9NO5 and a molecular weight of 665.55 g/mol. Its IUPAC name is 2-[4-[4-[[4-(1,3-benzodioxol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[4-[[4-(1,3-benzodioxol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46943289 |
| Molecular Formula | C31H28F9NO5 |
| Molecular Weight | 665.55 g/mol |
| Exact Mass | 665.18 |
| IUPAC Name | 2-[4-[4-[[4-(1,3-benzodioxol-5-ylmethyl)piperidin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OC(c1ccc(-c2ccc(CN3CCC(Cc4ccc5c(c4)OCO5)CC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H27F6NO3.C2HF3O2/c30-28(31,32)27(37,29(33,34)35)24-8-6-23(7-9-24)22-4-1-20(2-5-22)17-36-13-11-19(12-14-36)15-21-3-10-25-26(16-21)39-18-38-25;3-2(4,5)1(6)7/h1-10,16,19,37H,11-15,17-18H2;(H,6,7) |
| InChIKey | WIFDINHNLXNBRJ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.55 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |