C22H26F6N2O6 — CID 127022303
(3aR,6aS)-4-(1,3-benzodioxol-5-ylmethyl)-1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127022303) has the molecular formula C22H26F6N2O6 and a molecular weight of 528.45 g/mol. Its IUPAC name is (3aR,6aS)-4-(1,3-benzodioxol-5-ylmethyl)-1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,6aS)-4-(1,3-benzodioxol-5-ylmethyl)-1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022303 |
| Molecular Formula | C22H26F6N2O6 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | (3aR,6aS)-4-(1,3-benzodioxol-5-ylmethyl)-1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cc2c(cc1CN1CC[C@H]3[C@H]1CCN3CC1CC1)OCO2 |
| InChI | InChI=1S/C18H24N2O2.2C2HF3O2/c1-2-13(1)10-19-7-5-16-15(19)6-8-20(16)11-14-3-4-17-18(9-14)22-12-21-17;2*3-2(4,5)1(6)7/h3-4,9,13,15-16H,1-2,5-8,10-12H2;2*(H,6,7)/t15-,16+;;/m0../s1 |
| InChIKey | NBHKOYWFOLBXGM-SLAHTUFOSA-N |
| XLogP | 3.74 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |