C20H25F3N2O6 — CID 155843414
(2R,3aS,6aS)-4-(1,3-benzodioxol-5-ylmethyl)-N-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155843414) has the molecular formula C20H25F3N2O6 and a molecular weight of 446.42 g/mol. Its IUPAC name is (2R,3aS,6aS)-4-(1,3-benzodioxol-5-ylmethyl)-N-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,6aS)-4-(1,3-benzodioxol-5-ylmethyl)-N-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843414 |
| Molecular Formula | C20H25F3N2O6 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (2R,3aS,6aS)-4-(1,3-benzodioxol-5-ylmethyl)-N-propan-2-yl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)NC(=O)[C@H]1C[C@H]2[C@H](CCN2Cc2ccc3c(c2)OCO3)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N2O4.C2HF3O2/c1-11(2)19-18(21)17-8-13-14(24-17)5-6-20(13)9-12-3-4-15-16(7-12)23-10-22-15;3-2(4,5)1(6)7/h3-4,7,11,13-14,17H,5-6,8-10H2,1-2H3,(H,19,21);(H,6,7)/t13-,14-,17+;/m0./s1 |
| InChIKey | IUNKQWNWCPCKPF-ZUZBSIPJSA-N |
| XLogP | 2.31 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |