C31H29F9N2O5 — CID 46891657
2-[4-[4-[[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,2,2-trifluoroacetic acid (PubChem CID 46891657) has the molecular formula C31H29F9N2O5 and a molecular weight of 680.56 g/mol. Its IUPAC name is 2-[4-[4-[[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[4-[[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46891657 |
| Molecular Formula | C31H29F9N2O5 |
| Molecular Weight | 680.56 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | 2-[4-[4-[[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OC(c1ccc(-c2ccc(CN3CCN(CCc4ccc5c(c4)OCO5)CC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C29H28F6N2O3.C2HF3O2/c30-28(31,32)27(38,29(33,34)35)24-8-6-23(7-9-24)22-4-1-21(2-5-22)18-37-15-13-36(14-16-37)12-11-20-3-10-25-26(17-20)40-19-39-25;3-2(4,5)1(6)7/h1-10,17,38H,11-16,18-19H2;(H,6,7) |
| InChIKey | HCAOOMBNQXZREW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |