C22H26N2O4 — CID 137450994
1,4-bis[2-(1,3-benzodioxol-5-yl)ethyl]piperazine (PubChem CID 137450994) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1,4-bis[2-(1,3-benzodioxol-5-yl)ethyl]piperazine.
| Compound Name | 1,4-bis[2-(1,3-benzodioxol-5-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 137450994 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1,4-bis[2-(1,3-benzodioxol-5-yl)ethyl]piperazine |
| SMILES | c1cc2c(cc1CCN1CCN(CCc3ccc4c(c3)OCO4)CC1)OCO2 |
| InChI | InChI=1S/C22H26N2O4/c1-3-19-21(27-15-25-19)13-17(1)5-7-23-9-11-24(12-10-23)8-6-18-2-4-20-22(14-18)28-16-26-20/h1-4,13-14H,5-12,15-16H2 |
| InChIKey | YWOBLFHLBPKRMP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |