C21H26N2O3 — CID 24738725
1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(2-phenoxyethyl)piperazine (PubChem CID 24738725) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(2-phenoxyethyl)piperazine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(2-phenoxyethyl)piperazine |
|---|---|
| PubChem CID | 24738725 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(2-phenoxyethyl)piperazine |
| SMILES | c1ccc(OCCN2CCN(CCc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-2-4-19(5-3-1)24-15-14-23-12-10-22(11-13-23)9-8-18-6-7-20-21(16-18)26-17-25-20/h1-7,16H,8-15,17H2 |
| InChIKey | LCWJTHNDAYURKL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |