C20H23ClN2O2 — CID 69440754
1-[3-(1,3-benzodioxol-5-yl)propyl]-4-(4-chlorophenyl)piperazine (PubChem CID 69440754) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 1-[3-(1,3-benzodioxol-5-yl)propyl]-4-(4-chlorophenyl)piperazine.
| Compound Name | 1-[3-(1,3-benzodioxol-5-yl)propyl]-4-(4-chlorophenyl)piperazine |
|---|---|
| PubChem CID | 69440754 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-[3-(1,3-benzodioxol-5-yl)propyl]-4-(4-chlorophenyl)piperazine |
| SMILES | Clc1ccc(N2CCN(CCCc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C20H23ClN2O2/c21-17-4-6-18(7-5-17)23-12-10-22(11-13-23)9-1-2-16-3-8-19-20(14-16)25-15-24-19/h3-8,14H,1-2,9-13,15H2 |
| InChIKey | RPDGZIPNHMLYGV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |