C18H19ClN2O2 — CID 791218
1-(1,3-benzodioxol-5-ylmethyl)-4-(4-chlorophenyl)piperazine (PubChem CID 791218) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-(4-chlorophenyl)piperazine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(4-chlorophenyl)piperazine |
|---|---|
| PubChem CID | 791218 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(4-chlorophenyl)piperazine |
| SMILES | Clc1ccc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C18H19ClN2O2/c19-15-2-4-16(5-3-15)21-9-7-20(8-10-21)12-14-1-6-17-18(11-14)23-13-22-17/h1-6,11H,7-10,12-13H2 |
| InChIKey | RGOIDEZNTLCEEO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |