C17H17Cl2N3O2 — CID 17405853
1-(1,3-benzodioxol-5-ylmethyl)-4-(3,5-dichloro-2-pyridinyl)piperazine (PubChem CID 17405853) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-4-(3,5-dichloro-2-pyridinyl)piperazine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(3,5-dichloro-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 17405853 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-4-(3,5-dichloro-2-pyridinyl)piperazine |
| SMILES | Clc1cnc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c18-13-8-14(19)17(20-9-13)22-5-3-21(4-6-22)10-12-1-2-15-16(7-12)24-11-23-15/h1-2,7-9H,3-6,10-11H2 |
| InChIKey | MROAOVZJUHCMID-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |