C17H20N4O2 — CID 9161682
6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyridin-3-amine (PubChem CID 9161682) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyridin-3-amine.
| Compound Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 9161682 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyridin-3-amine |
| SMILES | Nc1ccc(N2CCN(Cc3ccc4c(c3)OCO4)CC2)nc1 |
| InChI | InChI=1S/C17H20N4O2/c18-14-2-4-17(19-10-14)21-7-5-20(6-8-21)11-13-1-3-15-16(9-13)23-12-22-15/h1-4,9-10H,5-8,11-12,18H2 |
| InChIKey | FQVROQKXLMFCJS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |