C18H22N4O2 — CID 67519518
6-[4-(1,3-benzodioxol-4-ylmethyl)-1,4-diazepan-1-yl]pyridin-3-amine (PubChem CID 67519518) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 6-[4-(1,3-benzodioxol-4-ylmethyl)-1,4-diazepan-1-yl]pyridin-3-amine.
| Compound Name | 6-[4-(1,3-benzodioxol-4-ylmethyl)-1,4-diazepan-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 67519518 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 6-[4-(1,3-benzodioxol-4-ylmethyl)-1,4-diazepan-1-yl]pyridin-3-amine |
| SMILES | Nc1ccc(N2CCCN(Cc3cccc4c3OCO4)CC2)nc1 |
| InChI | InChI=1S/C18H22N4O2/c19-15-5-6-17(20-11-15)22-8-2-7-21(9-10-22)12-14-3-1-4-16-18(14)24-13-23-16/h1,3-6,11H,2,7-10,12-13,19H2 |
| InChIKey | ZLNFVXVNNUQCGD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |