C13H17N5S — CID 112640956
6-[4-(1,3-thiazol-5-ylmethyl)piperazin-1-yl]pyridin-3-amine (PubChem CID 112640956) has the molecular formula C13H17N5S and a molecular weight of 275.38 g/mol. Its IUPAC name is 6-[4-(1,3-thiazol-5-ylmethyl)piperazin-1-yl]pyridin-3-amine.
| Compound Name | 6-[4-(1,3-thiazol-5-ylmethyl)piperazin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 112640956 |
| Molecular Formula | C13H17N5S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 6-[4-(1,3-thiazol-5-ylmethyl)piperazin-1-yl]pyridin-3-amine |
| SMILES | Nc1ccc(N2CCN(Cc3cncs3)CC2)nc1 |
| InChI | InChI=1S/C13H17N5S/c14-11-1-2-13(16-7-11)18-5-3-17(4-6-18)9-12-8-15-10-19-12/h1-2,7-8,10H,3-6,9,14H2 |
| InChIKey | VGRCSLMCMXTIFU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |