C9H15N3S — CID 18738462
5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazole (PubChem CID 18738462) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazole.
| Compound Name | 5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 18738462 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazole |
| SMILES | CN1CCN(Cc2cncs2)CC1 |
| InChI | InChI=1S/C9H15N3S/c1-11-2-4-12(5-3-11)7-9-6-10-8-13-9/h6,8H,2-5,7H2,1H3 |
| InChIKey | MLBZDUCFIXGRNU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |