C11H18N2O2S — CID 112548978
2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]oxyethanol (PubChem CID 112548978) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]oxyethanol.
| Compound Name | 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 112548978 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[1-(1,3-thiazol-5-ylmethyl)piperidin-4-yl]oxyethanol |
| SMILES | OCCOC1CCN(Cc2cncs2)CC1 |
| InChI | InChI=1S/C11H18N2O2S/c14-5-6-15-10-1-3-13(4-2-10)8-11-7-12-9-16-11/h7,9-10,14H,1-6,8H2 |
| InChIKey | UPTROJIYWYHPQU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |