C10H16N4S2 — CID 112640582
2-[4-(1,3-thiazol-5-ylmethyl)piperazin-1-yl]ethanethioamide (PubChem CID 112640582) has the molecular formula C10H16N4S2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 2-[4-(1,3-thiazol-5-ylmethyl)piperazin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(1,3-thiazol-5-ylmethyl)piperazin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 112640582 |
| Molecular Formula | C10H16N4S2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[4-(1,3-thiazol-5-ylmethyl)piperazin-1-yl]ethanethioamide |
| SMILES | NC(=S)CN1CCN(Cc2cncs2)CC1 |
| InChI | InChI=1S/C10H16N4S2/c11-10(15)7-14-3-1-13(2-4-14)6-9-5-12-8-16-9/h5,8H,1-4,6-7H2,(H2,11,15) |
| InChIKey | ARJDWSCCXDKUBO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|