C5H6N2S2 — CID 112640496
2-(1,3-thiazol-5-yl)ethanethioamide (PubChem CID 112640496) has the molecular formula C5H6N2S2 and a molecular weight of 158.25 g/mol. Its IUPAC name is 2-(1,3-thiazol-5-yl)ethanethioamide.
| Compound Name | 2-(1,3-thiazol-5-yl)ethanethioamide |
|---|---|
| PubChem CID | 112640496 |
| Molecular Formula | C5H6N2S2 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | 2-(1,3-thiazol-5-yl)ethanethioamide |
| SMILES | NC(=S)Cc1cncs1 |
| InChI | InChI=1S/C5H6N2S2/c6-5(8)1-4-2-7-3-9-4/h2-3H,1H2,(H2,6,8) |
| InChIKey | XPOKUPURRSWEFK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|