C8H11NO2S — CID 112642366
1-ethoxy-3-(1,3-thiazol-5-yl)propan-2-one (PubChem CID 112642366) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 1-ethoxy-3-(1,3-thiazol-5-yl)propan-2-one.
| Compound Name | 1-ethoxy-3-(1,3-thiazol-5-yl)propan-2-one |
|---|---|
| PubChem CID | 112642366 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 1-ethoxy-3-(1,3-thiazol-5-yl)propan-2-one |
| SMILES | CCOCC(=O)Cc1cncs1 |
| InChI | InChI=1S/C8H11NO2S/c1-2-11-5-7(10)3-8-4-9-6-12-8/h4,6H,2-3,5H2,1H3 |
| InChIKey | BRWSAWIEANDCQA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |