C12H19NO2S — CID 116747279
3-ethoxy-3-ethyl-1-(1,3-thiazol-5-yl)pentan-2-one (PubChem CID 116747279) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 3-ethoxy-3-ethyl-1-(1,3-thiazol-5-yl)pentan-2-one.
| Compound Name | 3-ethoxy-3-ethyl-1-(1,3-thiazol-5-yl)pentan-2-one |
|---|---|
| PubChem CID | 116747279 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-ethoxy-3-ethyl-1-(1,3-thiazol-5-yl)pentan-2-one |
| SMILES | CCOC(CC)(CC)C(=O)Cc1cncs1 |
| InChI | InChI=1S/C12H19NO2S/c1-4-12(5-2,15-6-3)11(14)7-10-8-13-9-16-10/h8-9H,4-7H2,1-3H3 |
| InChIKey | YUZGMGKFSOWYCI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |