C8H6N2OS2 — CID 112642435
1,2-bis(1,3-thiazol-5-yl)ethanone (PubChem CID 112642435) has the molecular formula C8H6N2OS2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1,2-bis(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1,2-bis(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 112642435 |
| Molecular Formula | C8H6N2OS2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 1,2-bis(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cncs1)c1cncs1 |
| InChI | InChI=1S/C8H6N2OS2/c11-7(8-3-10-5-13-8)1-6-2-9-4-12-6/h2-5H,1H2 |
| InChIKey | ZJKXWNCDABTNAO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |