C11H8FNOS — CID 112642213
1-(3-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 112642213) has the molecular formula C11H8FNOS and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(3-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 112642213 |
| Molecular Formula | C11H8FNOS |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 1-(3-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cncs1)c1cccc(F)c1 |
| InChI | InChI=1S/C11H8FNOS/c12-9-3-1-2-8(4-9)11(14)5-10-6-13-7-15-10/h1-4,6-7H,5H2 |
| InChIKey | IKAJNKFHRALCEM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |