C9H7NO2S — CID 112642317
1-(furan-3-yl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 112642317) has the molecular formula C9H7NO2S and a molecular weight of 193.23 g/mol. Its IUPAC name is 1-(furan-3-yl)-2-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(furan-3-yl)-2-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 112642317 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 1-(furan-3-yl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1cncs1)c1ccoc1 |
| InChI | InChI=1S/C9H7NO2S/c11-9(7-1-2-12-5-7)3-8-4-10-6-13-8/h1-2,4-6H,3H2 |
| InChIKey | AJVYIJOQJHCUCD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |