C10H9NO2S — CID 63948149
1-(furan-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone (PubChem CID 63948149) has the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. Its IUPAC name is 1-(furan-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(furan-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 63948149 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 1-(furan-3-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone |
| SMILES | Cc1csc(CC(=O)c2ccoc2)n1 |
| InChI | InChI=1S/C10H9NO2S/c1-7-6-14-10(11-7)4-9(12)8-2-3-13-5-8/h2-3,5-6H,4H2,1H3 |
| InChIKey | KNCMSEKFZGETRW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |