C6H7NNaO2S — CID 131842856
CID 131842856 (PubChem CID 131842856) has the molecular formula C6H7NNaO2S and a molecular weight of 180.18 g/mol.
| Compound Name | CID 131842856 |
|---|---|
| PubChem CID | 131842856 |
| Molecular Formula | C6H7NNaO2S |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | — |
| SMILES | Cc1csc(CC(=O)O)n1.[Na] |
| InChI | InChI=1S/C6H7NO2S.Na/c1-4-3-10-5(7-4)2-6(8)9;/h3H,2H2,1H3,(H,8,9); |
| InChIKey | AQJQBHQIJLYFFC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |