C14H16N2OS — CID 116553119
4-amino-1-(4-methyl-1,3-thiazol-2-yl)-4-phenylbutan-2-one (PubChem CID 116553119) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 4-amino-1-(4-methyl-1,3-thiazol-2-yl)-4-phenylbutan-2-one.
| Compound Name | 4-amino-1-(4-methyl-1,3-thiazol-2-yl)-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 116553119 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-amino-1-(4-methyl-1,3-thiazol-2-yl)-4-phenylbutan-2-one |
| SMILES | Cc1csc(CC(=O)CC(N)c2ccccc2)n1 |
| InChI | InChI=1S/C14H16N2OS/c1-10-9-18-14(16-10)8-12(17)7-13(15)11-5-3-2-4-6-11/h2-6,9,13H,7-8,15H2,1H3 |
| InChIKey | AZIOFLIUPKLVRL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |