C13H14N2OS — CID 116552998
4-amino-4-phenyl-1-(1,3-thiazol-2-yl)butan-2-one (PubChem CID 116552998) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 4-amino-4-phenyl-1-(1,3-thiazol-2-yl)butan-2-one.
| Compound Name | 4-amino-4-phenyl-1-(1,3-thiazol-2-yl)butan-2-one |
|---|---|
| PubChem CID | 116552998 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-amino-4-phenyl-1-(1,3-thiazol-2-yl)butan-2-one |
| SMILES | NC(CC(=O)Cc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C13H14N2OS/c14-12(10-4-2-1-3-5-10)8-11(16)9-13-15-6-7-17-13/h1-7,12H,8-9,14H2 |
| InChIKey | HRBLJKRONWHQGF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |