C19H15NO2S — CID 58541459
1-(2-benzoylphenyl)-3-(1,3-thiazol-2-yl)propan-2-one (PubChem CID 58541459) has the molecular formula C19H15NO2S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(2-benzoylphenyl)-3-(1,3-thiazol-2-yl)propan-2-one.
| Compound Name | 1-(2-benzoylphenyl)-3-(1,3-thiazol-2-yl)propan-2-one |
|---|---|
| PubChem CID | 58541459 |
| Molecular Formula | C19H15NO2S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-(2-benzoylphenyl)-3-(1,3-thiazol-2-yl)propan-2-one |
| SMILES | O=C(Cc1nccs1)Cc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H15NO2S/c21-16(13-18-20-10-11-23-18)12-15-8-4-5-9-17(15)19(22)14-6-2-1-3-7-14/h1-11H,12-13H2 |
| InChIKey | AZHGVDHGCULGCF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |