2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid

C13H13NO3S — CID 80741744

IUPAC2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid
SMILESCc1csc(COc2ccccc2CC(=O)O)n1
InChIInChI=1S/C13H13NO3S/c1-9-8-18-12(14-9)7-17-11-5-3-2-4-10(11)6-13(15)16/h2-5,8H,6-7H2,1H3,(H,15,16)
InChIKeyJKGYWELWMPBDEF-UHFFFAOYSA-N
MW263.32 g/mol
LogP2.66
Rot. Bonds5

About 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid

2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid (PubChem CID 80741744) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid.

Molecular Properties

Compound Name2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid
PubChem CID80741744
Molecular FormulaC13H13NO3S
Molecular Weight263.32 g/mol
Exact Mass263.06
IUPAC Name2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid
SMILESCc1csc(COc2ccccc2CC(=O)O)n1
InChIInChI=1S/C13H13NO3S/c1-9-8-18-12(14-9)7-17-11-5-3-2-4-10(11)6-13(15)16/h2-5,8H,6-7H2,1H3,(H,15,16)
InChIKeyJKGYWELWMPBDEF-UHFFFAOYSA-N
XLogP2.66
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.32
LogP ≤ 52.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid?
The IUPAC name of 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid (CID 80741744) is 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid.
What is the SMILES notation for 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid?
The canonical SMILES for 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid is Cc1csc(COc2ccccc2CC(=O)O)n1.
What is the InChIKey of 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid?
The InChIKey is JKGYWELWMPBDEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-9-8-18-12(14-9)7-17-11-5-3-2-4-10(11)6-13(15)16/h2-5,8H,6-7H2,1H3,(H,15,16).
What are the key properties of 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid?
2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid has a molecular weight of 263.32 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]acetic acid is sourced from PubChem (CID 80741744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).