C10H16N2OS — CID 116555711
5-(methylamino)-1-(4-methyl-1,3-thiazol-2-yl)pentan-2-one (PubChem CID 116555711) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 5-(methylamino)-1-(4-methyl-1,3-thiazol-2-yl)pentan-2-one.
| Compound Name | 5-(methylamino)-1-(4-methyl-1,3-thiazol-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 116555711 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-(methylamino)-1-(4-methyl-1,3-thiazol-2-yl)pentan-2-one |
| SMILES | CNCCCC(=O)Cc1nc(C)cs1 |
| InChI | InChI=1S/C10H16N2OS/c1-8-7-14-10(12-8)6-9(13)4-3-5-11-2/h7,11H,3-6H2,1-2H3 |
| InChIKey | ZFANOJZLZGRVEN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|