C12H23Cl2N3OS — CID 119879007
4-(methylamino)-N-[1-(4-methyl-1,3-thiazol-2-yl)propyl]butanamide;dihydrochloride (PubChem CID 119879007) has the molecular formula C12H23Cl2N3OS and a molecular weight of 328.31 g/mol. Its IUPAC name is 4-(methylamino)-N-[1-(4-methyl-1,3-thiazol-2-yl)propyl]butanamide;dihydrochloride.
| Compound Name | 4-(methylamino)-N-[1-(4-methyl-1,3-thiazol-2-yl)propyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119879007 |
| Molecular Formula | C12H23Cl2N3OS |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-(methylamino)-N-[1-(4-methyl-1,3-thiazol-2-yl)propyl]butanamide;dihydrochloride |
| SMILES | CCC(NC(=O)CCCNC)c1nc(C)cs1.Cl.Cl |
| InChI | InChI=1S/C12H21N3OS.2ClH/c1-4-10(12-14-9(2)8-17-12)15-11(16)6-5-7-13-3;;/h8,10,13H,4-7H2,1-3H3,(H,15,16);2*1H |
| InChIKey | WNKCFEIPOHGXLH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|