C12H16Cl2N2OS — CID 95334068
(1S)-2,2-dichloro-1-methyl-N-[(1S)-1-(4-methyl-1,3-thiazol-2-yl)propyl]cyclopropane-1-carboxamide (PubChem CID 95334068) has the molecular formula C12H16Cl2N2OS and a molecular weight of 307.25 g/mol. Its IUPAC name is (1S)-2,2-dichloro-1-methyl-N-[(1S)-1-(4-methyl-1,3-thiazol-2-yl)propyl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-1-methyl-N-[(1S)-1-(4-methyl-1,3-thiazol-2-yl)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95334068 |
| Molecular Formula | C12H16Cl2N2OS |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (1S)-2,2-dichloro-1-methyl-N-[(1S)-1-(4-methyl-1,3-thiazol-2-yl)propyl]cyclopropane-1-carboxamide |
| SMILES | CC[C@H](NC(=O)[C@]1(C)CC1(Cl)Cl)c1nc(C)cs1 |
| InChI | InChI=1S/C12H16Cl2N2OS/c1-4-8(9-15-7(2)5-18-9)16-10(17)11(3)6-12(11,13)14/h5,8H,4,6H2,1-3H3,(H,16,17)/t8-,11-/m0/s1 |
| InChIKey | DMKJJKOBUKTAGA-KWQFWETISA-N |
| XLogP | 3.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|