C14H21N3O2S — CID 111630943
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(4-methyl-1,3-thiazol-2-yl)propyl]urea (PubChem CID 111630943) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(4-methyl-1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(4-methyl-1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 111630943 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(4-methyl-1,3-thiazol-2-yl)propyl]urea |
| SMILES | CCC(NC(=O)N[C@@H]1C=C[C@H](CO)C1)c1nc(C)cs1 |
| InChI | InChI=1S/C14H21N3O2S/c1-3-12(13-15-9(2)8-20-13)17-14(19)16-11-5-4-10(6-11)7-18/h4-5,8,10-12,18H,3,6-7H2,1-2H3,(H2,16,17,19)/t10-,11+,12?/m0/s1 |
| InChIKey | JQMIFOIIZNECIO-WIKAKEFZSA-N |
| XLogP | 2.14 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|