C16H21N3O4 — CID 111795214
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(3-nitrophenyl)propyl]urea (PubChem CID 111795214) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(3-nitrophenyl)propyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(3-nitrophenyl)propyl]urea |
|---|---|
| PubChem CID | 111795214 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(3-nitrophenyl)propyl]urea |
| SMILES | CCC(NC(=O)N[C@@H]1C=C[C@H](CO)C1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21N3O4/c1-2-15(12-4-3-5-14(9-12)19(22)23)18-16(21)17-13-7-6-11(8-13)10-20/h3-7,9,11,13,15,20H,2,8,10H2,1H3,(H2,17,18,21)/t11-,13+,15?/m0/s1 |
| InChIKey | JJQADEFZZPLQGU-OZDYYWIQSA-N |
| XLogP | 2.28 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|