C15H20N2O3 — CID 99853716
[(1R,4S)-4-[[(1R)-1-(3-nitrophenyl)propyl]amino]cyclopent-2-en-1-yl]methanol (PubChem CID 99853716) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is [(1R,4S)-4-[[(1R)-1-(3-nitrophenyl)propyl]amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[[(1R)-1-(3-nitrophenyl)propyl]amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 99853716 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | [(1R,4S)-4-[[(1R)-1-(3-nitrophenyl)propyl]amino]cyclopent-2-en-1-yl]methanol |
| SMILES | CC[C@@H](N[C@@H]1C=C[C@H](CO)C1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H20N2O3/c1-2-15(16-13-7-6-11(8-13)10-18)12-4-3-5-14(9-12)17(19)20/h3-7,9,11,13,15-16,18H,2,8,10H2,1H3/t11-,13+,15+/m0/s1 |
| InChIKey | MABSZHJQXQFYBD-NJZAAPMLSA-N |
| XLogP | 2.57 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|