C16H22N2O2 — CID 111630257
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(2-methylphenyl)ethyl]urea (PubChem CID 111630257) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(2-methylphenyl)ethyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(2-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 111630257 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[1-(2-methylphenyl)ethyl]urea |
| SMILES | Cc1ccccc1C(C)NC(=O)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C16H22N2O2/c1-11-5-3-4-6-15(11)12(2)17-16(20)18-14-8-7-13(9-14)10-19/h3-8,12-14,19H,9-10H2,1-2H3,(H2,17,18,20)/t12?,13-,14+/m0/s1 |
| InChIKey | YKVOLLUELHBZTB-KFTPUPIBSA-N |
| XLogP | 2.29 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|