C19H22N2O2S — CID 111631065
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(2-phenyl-1-thiophen-2-ylethyl)urea (PubChem CID 111631065) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(2-phenyl-1-thiophen-2-ylethyl)urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(2-phenyl-1-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 111631065 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-(2-phenyl-1-thiophen-2-ylethyl)urea |
| SMILES | O=C(NC(Cc1ccccc1)c1cccs1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C19H22N2O2S/c22-13-15-8-9-16(11-15)20-19(23)21-17(18-7-4-10-24-18)12-14-5-2-1-3-6-14/h1-10,15-17,22H,11-13H2,(H2,20,21,23)/t15-,16+,17?/m0/s1 |
| InChIKey | DHKOGJCQEKAQSN-RTKIROINSA-N |
| XLogP | 3.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|