C18H26N2O2S — CID 111631122
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(1-thiophen-2-ylcyclohexyl)methyl]urea (PubChem CID 111631122) has the molecular formula C18H26N2O2S and a molecular weight of 334.49 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(1-thiophen-2-ylcyclohexyl)methyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(1-thiophen-2-ylcyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111631122 |
| Molecular Formula | C18H26N2O2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(1-thiophen-2-ylcyclohexyl)methyl]urea |
| SMILES | O=C(NCC1(c2cccs2)CCCCC1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C18H26N2O2S/c21-12-14-6-7-15(11-14)20-17(22)19-13-18(8-2-1-3-9-18)16-5-4-10-23-16/h4-7,10,14-15,21H,1-3,8-9,11-13H2,(H2,19,20,22)/t14-,15+/m0/s1 |
| InChIKey | BABBWIHKTVLMNP-LSDHHAIUSA-N |
| XLogP | 3.19 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|