C18H31ClN2OS — CID 119799163
7-amino-N-[(1-thiophen-2-ylcyclohexyl)methyl]heptanamide;hydrochloride (PubChem CID 119799163) has the molecular formula C18H31ClN2OS and a molecular weight of 358.98 g/mol. Its IUPAC name is 7-amino-N-[(1-thiophen-2-ylcyclohexyl)methyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[(1-thiophen-2-ylcyclohexyl)methyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119799163 |
| Molecular Formula | C18H31ClN2OS |
| Molecular Weight | 358.98 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 7-amino-N-[(1-thiophen-2-ylcyclohexyl)methyl]heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)NCC1(c2cccs2)CCCCC1 |
| InChI | InChI=1S/C18H30N2OS.ClH/c19-13-7-2-1-4-10-17(21)20-15-18(11-5-3-6-12-18)16-9-8-14-22-16;/h8-9,14H,1-7,10-13,15,19H2,(H,20,21);1H |
| InChIKey | GAUHDHONMRNIGV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.98 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|