C18H27ClN2O — CID 119769932
7-amino-N-[[1-(4-chlorophenyl)cyclobutyl]methyl]heptanamide (PubChem CID 119769932) has the molecular formula C18H27ClN2O and a molecular weight of 322.88 g/mol. Its IUPAC name is 7-amino-N-[[1-(4-chlorophenyl)cyclobutyl]methyl]heptanamide.
| Compound Name | 7-amino-N-[[1-(4-chlorophenyl)cyclobutyl]methyl]heptanamide |
|---|---|
| PubChem CID | 119769932 |
| Molecular Formula | C18H27ClN2O |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 7-amino-N-[[1-(4-chlorophenyl)cyclobutyl]methyl]heptanamide |
| SMILES | NCCCCCCC(=O)NCC1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C18H27ClN2O/c19-16-9-7-15(8-10-16)18(11-5-12-18)14-21-17(22)6-3-1-2-4-13-20/h7-10H,1-6,11-14,20H2,(H,21,22) |
| InChIKey | IBSPUOAGQGDSSJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|