C16H20N2O2 — CID 111631019
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(E)-3-phenylprop-2-enyl]urea (PubChem CID 111631019) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(E)-3-phenylprop-2-enyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(E)-3-phenylprop-2-enyl]urea |
|---|---|
| PubChem CID | 111631019 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(E)-3-phenylprop-2-enyl]urea |
| SMILES | O=C(NC/C=C/c1ccccc1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C16H20N2O2/c19-12-14-8-9-15(11-14)18-16(20)17-10-4-7-13-5-2-1-3-6-13/h1-9,14-15,19H,10-12H2,(H2,17,18,20)/b7-4+/t14-,15+/m0/s1 |
| InChIKey | ZFXFDAKPGJVAOC-SJPZSHDVSA-N |
| XLogP | 1.94 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|